About 4-ethenyl-3-[(Z)-3-fluoroprop-1-enyl]-1,2-dihydropyrrol-5-one
4-ethenyl-3-[(Z)-3-fluoroprop-1-enyl]-1,2-dihydropyrrol-5-one (PubChem CID 89344172) has the molecular formula C9H10FNO
and a molecular weight of 167.18 g/mol. Its IUPAC name is 4-ethenyl-3-[(Z)-3-fluoroprop-1-enyl]-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 4-ethenyl-3-[(Z)-3-fluoroprop-1-enyl]-1,2-dihydropyrrol-5-one |
| PubChem CID | 89344172 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 4-ethenyl-3-[(Z)-3-fluoroprop-1-enyl]-1,2-dihydropyrrol-5-one |
| SMILES | C=CC1=C(/C=C\CF)CNC1=O |
| InChI | InChI=1S/C9H10FNO/c1-2-8-7(4-3-5-10)6-11-9(8)12/h2-4H,1,5-6H2,(H,11,12)/b4-3- |
| InChIKey | WVPROARCDFBVDD-ARJAWSKDSA-N |
| XLogP | 1.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethenyl-3-[(Z)-3-fluoroprop-1-enyl]-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-3-[(Z)-3-fluoroprop-1-enyl]-1,2-dihydropyrrol-5-one?
The IUPAC name of 4-ethenyl-3-[(Z)-3-fluoroprop-1-enyl]-1,2-dihydropyrrol-5-one (CID 89344172) is 4-ethenyl-3-[(Z)-3-fluoroprop-1-enyl]-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 4-ethenyl-3-[(Z)-3-fluoroprop-1-enyl]-1,2-dihydropyrrol-5-one?
The canonical SMILES for 4-ethenyl-3-[(Z)-3-fluoroprop-1-enyl]-1,2-dihydropyrrol-5-one is C=CC1=C(/C=C\CF)CNC1=O.
What is the InChIKey of 4-ethenyl-3-[(Z)-3-fluoroprop-1-enyl]-1,2-dihydropyrrol-5-one?
The InChIKey is WVPROARCDFBVDD-ARJAWSKDSA-N. The full InChI is InChI=1S/C9H10FNO/c1-2-8-7(4-3-5-10)6-11-9(8)12/h2-4H,1,5-6H2,(H,11,12)/b4-3-.
What are the key properties of 4-ethenyl-3-[(Z)-3-fluoroprop-1-enyl]-1,2-dihydropyrrol-5-one?
4-ethenyl-3-[(Z)-3-fluoroprop-1-enyl]-1,2-dihydropyrrol-5-one has a molecular weight of 167.18 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-3-[(Z)-3-fluoroprop-1-enyl]-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 89344172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).