About 3-[(2E)-5-methylhexa-2,4-dien-2-yl]-1,2-oxazole
3-[(2E)-5-methylhexa-2,4-dien-2-yl]-1,2-oxazole (PubChem CID 89344233) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-[(2E)-5-methylhexa-2,4-dien-2-yl]-1,2-oxazole.
Molecular Properties
| Compound Name | 3-[(2E)-5-methylhexa-2,4-dien-2-yl]-1,2-oxazole |
| PubChem CID | 89344233 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 3-[(2E)-5-methylhexa-2,4-dien-2-yl]-1,2-oxazole |
| SMILES | CC(C)=C/C=C(\C)c1ccon1 |
| InChI | InChI=1S/C10H13NO/c1-8(2)4-5-9(3)10-6-7-12-11-10/h4-7H,1-3H3/b9-5+ |
| InChIKey | PZFDJFNKGROXIS-WEVVVXLNSA-N |
| XLogP | 3.04 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2E)-5-methylhexa-2,4-dien-2-yl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2E)-5-methylhexa-2,4-dien-2-yl]-1,2-oxazole?
The IUPAC name of 3-[(2E)-5-methylhexa-2,4-dien-2-yl]-1,2-oxazole (CID 89344233) is 3-[(2E)-5-methylhexa-2,4-dien-2-yl]-1,2-oxazole.
What is the SMILES notation for 3-[(2E)-5-methylhexa-2,4-dien-2-yl]-1,2-oxazole?
The canonical SMILES for 3-[(2E)-5-methylhexa-2,4-dien-2-yl]-1,2-oxazole is CC(C)=C/C=C(\C)c1ccon1.
What is the InChIKey of 3-[(2E)-5-methylhexa-2,4-dien-2-yl]-1,2-oxazole?
The InChIKey is PZFDJFNKGROXIS-WEVVVXLNSA-N. The full InChI is InChI=1S/C10H13NO/c1-8(2)4-5-9(3)10-6-7-12-11-10/h4-7H,1-3H3/b9-5+.
What are the key properties of 3-[(2E)-5-methylhexa-2,4-dien-2-yl]-1,2-oxazole?
3-[(2E)-5-methylhexa-2,4-dien-2-yl]-1,2-oxazole has a molecular weight of 163.22 g/mol, XLogP of 3.04, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2E)-5-methylhexa-2,4-dien-2-yl]-1,2-oxazole is sourced from PubChem (CID 89344233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).