About 4-cyclohexa-1,5-dien-1-yl-3,4-dihydropyridin-2-amine
4-cyclohexa-1,5-dien-1-yl-3,4-dihydropyridin-2-amine (PubChem CID 89344256) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-3,4-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-3,4-dihydropyridin-2-amine |
| PubChem CID | 89344256 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-3,4-dihydropyridin-2-amine |
| SMILES | NC1=NC=CC(C2=CCCC=C2)C1 |
| InChI | InChI=1S/C11H14N2/c12-11-8-10(6-7-13-11)9-4-2-1-3-5-9/h2,4-7,10H,1,3,8H2,(H2,12,13) |
| InChIKey | BBSNGUOIOFGHGC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclohexa-1,5-dien-1-yl-3,4-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexa-1,5-dien-1-yl-3,4-dihydropyridin-2-amine?
The IUPAC name of 4-cyclohexa-1,5-dien-1-yl-3,4-dihydropyridin-2-amine (CID 89344256) is 4-cyclohexa-1,5-dien-1-yl-3,4-dihydropyridin-2-amine.
What is the SMILES notation for 4-cyclohexa-1,5-dien-1-yl-3,4-dihydropyridin-2-amine?
The canonical SMILES for 4-cyclohexa-1,5-dien-1-yl-3,4-dihydropyridin-2-amine is NC1=NC=CC(C2=CCCC=C2)C1.
What is the InChIKey of 4-cyclohexa-1,5-dien-1-yl-3,4-dihydropyridin-2-amine?
The InChIKey is BBSNGUOIOFGHGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c12-11-8-10(6-7-13-11)9-4-2-1-3-5-9/h2,4-7,10H,1,3,8H2,(H2,12,13).
What are the key properties of 4-cyclohexa-1,5-dien-1-yl-3,4-dihydropyridin-2-amine?
4-cyclohexa-1,5-dien-1-yl-3,4-dihydropyridin-2-amine has a molecular weight of 174.25 g/mol, XLogP of 2.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexa-1,5-dien-1-yl-3,4-dihydropyridin-2-amine is sourced from PubChem (CID 89344256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).