C16H10F7NO2 — CID 89344316
1-[6-[[2-(2,4-difluorophenyl)oxiran-2-yl]-difluoromethyl]-3-pyridinyl]-2,2,2-trifluoroethanol (PubChem CID 89344316) has the molecular formula C16H10F7NO2 and a molecular weight of 381.25 g/mol. Its IUPAC name is 1-[6-[[2-(2,4-difluorophenyl)oxiran-2-yl]-difluoromethyl]-3-pyridinyl]-2,2,2-trifluoroethanol.
| Compound Name | 1-[6-[[2-(2,4-difluorophenyl)oxiran-2-yl]-difluoromethyl]-3-pyridinyl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 89344316 |
| Molecular Formula | C16H10F7NO2 |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 1-[6-[[2-(2,4-difluorophenyl)oxiran-2-yl]-difluoromethyl]-3-pyridinyl]-2,2,2-trifluoroethanol |
| SMILES | OC(c1ccc(C(F)(F)C2(c3ccc(F)cc3F)CO2)nc1)C(F)(F)F |
| InChI | InChI=1S/C16H10F7NO2/c17-9-2-3-10(11(18)5-9)14(7-26-14)15(19,20)12-4-1-8(6-24-12)13(25)16(21,22)23/h1-6,13,25H,7H2 |
| InChIKey | GVSQKIVPIHKZSG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|