C19H16O7 — CID 89344353
2-[(Z)-1,2-dihydroxyethenyl]-5,10-dimethoxy-1,2-dihydrofuro[2,3-c]xanthen-6-one (PubChem CID 89344353) has the molecular formula C19H16O7 and a molecular weight of 356.33 g/mol. Its IUPAC name is 2-[(Z)-1,2-dihydroxyethenyl]-5,10-dimethoxy-1,2-dihydrofuro[2,3-c]xanthen-6-one.
| Compound Name | 2-[(Z)-1,2-dihydroxyethenyl]-5,10-dimethoxy-1,2-dihydrofuro[2,3-c]xanthen-6-one |
|---|---|
| PubChem CID | 89344353 |
| Molecular Formula | C19H16O7 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2-[(Z)-1,2-dihydroxyethenyl]-5,10-dimethoxy-1,2-dihydrofuro[2,3-c]xanthen-6-one |
| SMILES | COc1cccc2c(=O)c3c(OC)cc4c(c3oc12)CC(/C(O)=C/O)O4 |
| InChI | InChI=1S/C19H16O7/c1-23-12-5-3-4-9-17(22)16-15(24-2)7-13-10(19(16)26-18(9)12)6-14(25-13)11(21)8-20/h3-5,7-8,14,20-21H,6H2,1-2H3/b11-8- |
| InChIKey | GIKAHKCKFVIBJA-FLIBITNWSA-N |
| XLogP | 3.22 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|