About [1]benzofuro[3,2-b]quinoxaline
[1]benzofuro[3,2-b]quinoxaline (PubChem CID 8934436) has the molecular formula C14H8N2O
and a molecular weight of 220.23 g/mol. Its IUPAC name is [1]benzofuro[3,2-b]quinoxaline.
Molecular Properties
| Compound Name | [1]benzofuro[3,2-b]quinoxaline |
| PubChem CID | 8934436 |
| Molecular Formula | C14H8N2O |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | [1]benzofuro[3,2-b]quinoxaline |
| SMILES | c1ccc2nc3c(nc2c1)oc1ccccc13 |
| InChI | InChI=1S/C14H8N2O/c1-4-8-12-9(5-1)13-14(17-12)16-11-7-3-2-6-10(11)15-13/h1-8H |
| InChIKey | KUQYJVRYTBTUOX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1]benzofuro[3,2-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1]benzofuro[3,2-b]quinoxaline?
The IUPAC name of [1]benzofuro[3,2-b]quinoxaline (CID 8934436) is [1]benzofuro[3,2-b]quinoxaline.
What is the SMILES notation for [1]benzofuro[3,2-b]quinoxaline?
The canonical SMILES for [1]benzofuro[3,2-b]quinoxaline is c1ccc2nc3c(nc2c1)oc1ccccc13.
What is the InChIKey of [1]benzofuro[3,2-b]quinoxaline?
The InChIKey is KUQYJVRYTBTUOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2O/c1-4-8-12-9(5-1)13-14(17-12)16-11-7-3-2-6-10(11)15-13/h1-8H.
What are the key properties of [1]benzofuro[3,2-b]quinoxaline?
[1]benzofuro[3,2-b]quinoxaline has a molecular weight of 220.23 g/mol, XLogP of 3.53, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1]benzofuro[3,2-b]quinoxaline is sourced from PubChem (CID 8934436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).