About (5R)-5-fluoro-2-iodo-3-methylidene-4,5-dihydro-1H-isoindole
(5R)-5-fluoro-2-iodo-3-methylidene-4,5-dihydro-1H-isoindole (PubChem CID 89344451) has the molecular formula C9H9FIN
and a molecular weight of 277.08 g/mol. Its IUPAC name is (5R)-5-fluoro-2-iodo-3-methylidene-4,5-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | (5R)-5-fluoro-2-iodo-3-methylidene-4,5-dihydro-1H-isoindole |
| PubChem CID | 89344451 |
| Molecular Formula | C9H9FIN |
| Molecular Weight | 277.08 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | (5R)-5-fluoro-2-iodo-3-methylidene-4,5-dihydro-1H-isoindole |
| SMILES | C=C1C2=C(C=C[C@H](F)C2)CN1I |
| InChI | InChI=1S/C9H9FIN/c1-6-9-4-8(10)3-2-7(9)5-12(6)11/h2-3,8H,1,4-5H2/t8-/m0/s1 |
| InChIKey | KGHZFAAXBQYHDG-QMMMGPOBSA-N |
| XLogP | 2.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.08 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-fluoro-2-iodo-3-methylidene-4,5-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-fluoro-2-iodo-3-methylidene-4,5-dihydro-1H-isoindole?
The IUPAC name of (5R)-5-fluoro-2-iodo-3-methylidene-4,5-dihydro-1H-isoindole (CID 89344451) is (5R)-5-fluoro-2-iodo-3-methylidene-4,5-dihydro-1H-isoindole.
What is the SMILES notation for (5R)-5-fluoro-2-iodo-3-methylidene-4,5-dihydro-1H-isoindole?
The canonical SMILES for (5R)-5-fluoro-2-iodo-3-methylidene-4,5-dihydro-1H-isoindole is C=C1C2=C(C=C[C@H](F)C2)CN1I.
What is the InChIKey of (5R)-5-fluoro-2-iodo-3-methylidene-4,5-dihydro-1H-isoindole?
The InChIKey is KGHZFAAXBQYHDG-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H9FIN/c1-6-9-4-8(10)3-2-7(9)5-12(6)11/h2-3,8H,1,4-5H2/t8-/m0/s1.
What are the key properties of (5R)-5-fluoro-2-iodo-3-methylidene-4,5-dihydro-1H-isoindole?
(5R)-5-fluoro-2-iodo-3-methylidene-4,5-dihydro-1H-isoindole has a molecular weight of 277.08 g/mol, XLogP of 2.76, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-fluoro-2-iodo-3-methylidene-4,5-dihydro-1H-isoindole is sourced from PubChem (CID 89344451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).