C8H12O2 — CID 89344777
(2Z,4E)-4-methoxyhepta-2,4,6-trien-1-ol (PubChem CID 89344777) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (2Z,4E)-4-methoxyhepta-2,4,6-trien-1-ol.
| Compound Name | (2Z,4E)-4-methoxyhepta-2,4,6-trien-1-ol |
|---|---|
| PubChem CID | 89344777 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (2Z,4E)-4-methoxyhepta-2,4,6-trien-1-ol |
| SMILES | C=C/C=C(\C=C/CO)OC |
| InChI | InChI=1S/C8H12O2/c1-3-5-8(10-2)6-4-7-9/h3-6,9H,1,7H2,2H3/b6-4-,8-5+ |
| InChIKey | IYJFBFBSVSGCDF-QXMOYCCXSA-N |
| XLogP | 1.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|