About 4-[1-cyclobutyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-6-(oxan-4-yloxy)indol-2-yl]aniline
4-[1-cyclobutyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-6-(oxan-4-yloxy)indol-2-yl]aniline (PubChem CID 89344833) has the molecular formula C28H31N3O3
and a molecular weight of 457.57 g/mol. Its IUPAC name is 4-[1-cyclobutyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-6-(oxan-4-yloxy)indol-2-yl]aniline.
Molecular Properties
| Compound Name | 4-[1-cyclobutyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-6-(oxan-4-yloxy)indol-2-yl]aniline |
| PubChem CID | 89344833 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 4-[1-cyclobutyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-6-(oxan-4-yloxy)indol-2-yl]aniline |
| SMILES | Cc1nc(-c2c(-c3ccc(N)cc3)n(C3CCC3)c3cc(OC4CCOCC4)ccc23)oc1C |
| InChI | InChI=1S/C28H31N3O3/c1-17-18(2)33-28(30-17)26-24-11-10-23(34-22-12-14-32-15-13-22)16-25(24)31(21-4-3-5-21)27(26)19-6-8-20(29)9-7-19/h6-11,16,21-22H,3-5,12-15,29H2,1-2H3 |
| InChIKey | LLVYRYKNMFLNBE-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-cyclobutyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-6-(oxan-4-yloxy)indol-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-cyclobutyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-6-(oxan-4-yloxy)indol-2-yl]aniline?
The IUPAC name of 4-[1-cyclobutyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-6-(oxan-4-yloxy)indol-2-yl]aniline (CID 89344833) is 4-[1-cyclobutyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-6-(oxan-4-yloxy)indol-2-yl]aniline.
What is the SMILES notation for 4-[1-cyclobutyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-6-(oxan-4-yloxy)indol-2-yl]aniline?
The canonical SMILES for 4-[1-cyclobutyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-6-(oxan-4-yloxy)indol-2-yl]aniline is Cc1nc(-c2c(-c3ccc(N)cc3)n(C3CCC3)c3cc(OC4CCOCC4)ccc23)oc1C.
What is the InChIKey of 4-[1-cyclobutyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-6-(oxan-4-yloxy)indol-2-yl]aniline?
The InChIKey is LLVYRYKNMFLNBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H31N3O3/c1-17-18(2)33-28(30-17)26-24-11-10-23(34-22-12-14-32-15-13-22)16-25(24)31(21-4-3-5-21)27(26)19-6-8-20(29)9-7-19/h6-11,16,21-22H,3-5,12-15,29H2,1-2H3.
What are the key properties of 4-[1-cyclobutyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-6-(oxan-4-yloxy)indol-2-yl]aniline?
4-[1-cyclobutyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-6-(oxan-4-yloxy)indol-2-yl]aniline has a molecular weight of 457.57 g/mol, XLogP of 6.45, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-cyclobutyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-6-(oxan-4-yloxy)indol-2-yl]aniline is sourced from PubChem (CID 89344833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).