C19H28FNO — CID 89344837
8-cyclohexyl-3-[(1Z,3E)-3-fluoropenta-1,3-dienyl]-2-oxa-8-azaspiro[4.5]dec-3-ene (PubChem CID 89344837) has the molecular formula C19H28FNO and a molecular weight of 305.44 g/mol. Its IUPAC name is 8-cyclohexyl-3-[(1Z,3E)-3-fluoropenta-1,3-dienyl]-2-oxa-8-azaspiro[4.5]dec-3-ene.
| Compound Name | 8-cyclohexyl-3-[(1Z,3E)-3-fluoropenta-1,3-dienyl]-2-oxa-8-azaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 89344837 |
| Molecular Formula | C19H28FNO |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 8-cyclohexyl-3-[(1Z,3E)-3-fluoropenta-1,3-dienyl]-2-oxa-8-azaspiro[4.5]dec-3-ene |
| SMILES | C/C=C(F)\C=C/C1=CC2(CCN(C3CCCCC3)CC2)CO1 |
| InChI | InChI=1S/C19H28FNO/c1-2-16(20)8-9-18-14-19(15-22-18)10-12-21(13-11-19)17-6-4-3-5-7-17/h2,8-9,14,17H,3-7,10-13,15H2,1H3/b9-8-,16-2+ |
| InChIKey | DPXMIBSZBSPZFB-VRAHBGQZSA-N |
| XLogP | 4.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|