About methyl 4-(5-fluoro-1-formylspiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate
methyl 4-(5-fluoro-1-formylspiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate (PubChem CID 89344844) has the molecular formula C20H26FN3O3
and a molecular weight of 375.44 g/mol. Its IUPAC name is methyl 4-(5-fluoro-1-formylspiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(5-fluoro-1-formylspiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate |
| PubChem CID | 89344844 |
| Molecular Formula | C20H26FN3O3 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | methyl 4-(5-fluoro-1-formylspiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(N2CCC3(CC2)CN(C=O)c2ccc(F)cc23)CC1 |
| InChI | InChI=1S/C20H26FN3O3/c1-27-19(26)23-8-4-16(5-9-23)22-10-6-20(7-11-22)13-24(14-25)18-3-2-15(21)12-17(18)20/h2-3,12,14,16H,4-11,13H2,1H3 |
| InChIKey | UWUQQMITAWAWLW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(5-fluoro-1-formylspiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(5-fluoro-1-formylspiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate?
The IUPAC name of methyl 4-(5-fluoro-1-formylspiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate (CID 89344844) is methyl 4-(5-fluoro-1-formylspiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate.
What is the SMILES notation for methyl 4-(5-fluoro-1-formylspiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate?
The canonical SMILES for methyl 4-(5-fluoro-1-formylspiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate is COC(=O)N1CCC(N2CCC3(CC2)CN(C=O)c2ccc(F)cc23)CC1.
What is the InChIKey of methyl 4-(5-fluoro-1-formylspiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate?
The InChIKey is UWUQQMITAWAWLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26FN3O3/c1-27-19(26)23-8-4-16(5-9-23)22-10-6-20(7-11-22)13-24(14-25)18-3-2-15(21)12-17(18)20/h2-3,12,14,16H,4-11,13H2,1H3.
What are the key properties of methyl 4-(5-fluoro-1-formylspiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate?
methyl 4-(5-fluoro-1-formylspiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate has a molecular weight of 375.44 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(5-fluoro-1-formylspiro[2H-indole-3,4'-piperidine]-1'-yl)piperidine-1-carboxylate is sourced from PubChem (CID 89344844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).