2-(5-nitro-2,3-dihydrothiophen-3-yl)acetic acid

C6H7NO4S — CID 89344863

IUPAC2-(5-nitro-2,3-dihydrothiophen-3-yl)acetic acid
SMILESO=C(O)CC1C=C([N+](=O)[O-])SC1
InChIInChI=1S/C6H7NO4S/c8-6(9)2-4-1-5(7(10)11)12-3-4/h1,4H,2-3H2,(H,8,9)
InChIKeySYLIQMAHEFXSLK-UHFFFAOYSA-N
MW189.19 g/mol
LogP0.94
Rot. Bonds3

About 2-(5-nitro-2,3-dihydrothiophen-3-yl)acetic acid

2-(5-nitro-2,3-dihydrothiophen-3-yl)acetic acid (PubChem CID 89344863) has the molecular formula C6H7NO4S and a molecular weight of 189.19 g/mol. Its IUPAC name is 2-(5-nitro-2,3-dihydrothiophen-3-yl)acetic acid.

Molecular Properties

Compound Name2-(5-nitro-2,3-dihydrothiophen-3-yl)acetic acid
PubChem CID89344863
Molecular FormulaC6H7NO4S
Molecular Weight189.19 g/mol
Exact Mass189.01
IUPAC Name2-(5-nitro-2,3-dihydrothiophen-3-yl)acetic acid
SMILESO=C(O)CC1C=C([N+](=O)[O-])SC1
InChIInChI=1S/C6H7NO4S/c8-6(9)2-4-1-5(7(10)11)12-3-4/h1,4H,2-3H2,(H,8,9)
InChIKeySYLIQMAHEFXSLK-UHFFFAOYSA-N
XLogP0.94
TPSA80.44 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.19
LogP ≤ 50.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(5-nitro-2,3-dihydrothiophen-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-nitro-2,3-dihydrothiophen-3-yl)acetic acid?
The IUPAC name of 2-(5-nitro-2,3-dihydrothiophen-3-yl)acetic acid (CID 89344863) is 2-(5-nitro-2,3-dihydrothiophen-3-yl)acetic acid.
What is the SMILES notation for 2-(5-nitro-2,3-dihydrothiophen-3-yl)acetic acid?
The canonical SMILES for 2-(5-nitro-2,3-dihydrothiophen-3-yl)acetic acid is O=C(O)CC1C=C([N+](=O)[O-])SC1.
What is the InChIKey of 2-(5-nitro-2,3-dihydrothiophen-3-yl)acetic acid?
The InChIKey is SYLIQMAHEFXSLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO4S/c8-6(9)2-4-1-5(7(10)11)12-3-4/h1,4H,2-3H2,(H,8,9).
What are the key properties of 2-(5-nitro-2,3-dihydrothiophen-3-yl)acetic acid?
2-(5-nitro-2,3-dihydrothiophen-3-yl)acetic acid has a molecular weight of 189.19 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-nitro-2,3-dihydrothiophen-3-yl)acetic acid is sourced from PubChem (CID 89344863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).