C16H27ClN2 — CID 89344907
(4Z,6Z)-1-N-(chloromethyl)-1-N'-[(1S)-2-methylidenecyclohexyl]octa-4,6-diene-1,1-diamine (PubChem CID 89344907) has the molecular formula C16H27ClN2 and a molecular weight of 282.86 g/mol. Its IUPAC name is (4Z,6Z)-1-N-(chloromethyl)-1-N'-[(1S)-2-methylidenecyclohexyl]octa-4,6-diene-1,1-diamine.
| Compound Name | (4Z,6Z)-1-N-(chloromethyl)-1-N'-[(1S)-2-methylidenecyclohexyl]octa-4,6-diene-1,1-diamine |
|---|---|
| PubChem CID | 89344907 |
| Molecular Formula | C16H27ClN2 |
| Molecular Weight | 282.86 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | (4Z,6Z)-1-N-(chloromethyl)-1-N'-[(1S)-2-methylidenecyclohexyl]octa-4,6-diene-1,1-diamine |
| SMILES | C=C1CCCC[C@@H]1NC(CC/C=C\C=C/C)NCCl |
| InChI | InChI=1S/C16H27ClN2/c1-3-4-5-6-7-12-16(18-13-17)19-15-11-9-8-10-14(15)2/h3-6,15-16,18-19H,2,7-13H2,1H3/b4-3-,6-5-/t15-,16?/m0/s1 |
| InChIKey | JZDQFMRWEZRQCL-FNWWADCRSA-N |
| XLogP | 4.10 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.86 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|