C12H18N4 — CID 89344936
7-imino-2,3,5,8-tetramethyl-4,6-dihydro-3H-quinoxalin-6-amine (PubChem CID 89344936) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is 7-imino-2,3,5,8-tetramethyl-4,6-dihydro-3H-quinoxalin-6-amine.
| Compound Name | 7-imino-2,3,5,8-tetramethyl-4,6-dihydro-3H-quinoxalin-6-amine |
|---|---|
| PubChem CID | 89344936 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 7-imino-2,3,5,8-tetramethyl-4,6-dihydro-3H-quinoxalin-6-amine |
| SMILES | [H]/N=C1\C(C)=C2N=C(C)C(C)NC2=C(C)C1N |
| InChI | InChI=1S/C12H18N4/c1-5-9(13)10(14)6(2)12-11(5)15-7(3)8(4)16-12/h7,9,14-15H,13H2,1-4H3/b14-10+ |
| InChIKey | BPBXECFRVLRPGF-GXDHUFHOSA-N |
| XLogP | 1.35 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|