C10H6F6O — CID 89344984
1-(2,2-difluoroethoxy)-3-ethenyl-2,4,5,6-tetrafluorobenzene (PubChem CID 89344984) has the molecular formula C10H6F6O and a molecular weight of 256.14 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-3-ethenyl-2,4,5,6-tetrafluorobenzene.
| Compound Name | 1-(2,2-difluoroethoxy)-3-ethenyl-2,4,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 89344984 |
| Molecular Formula | C10H6F6O |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-3-ethenyl-2,4,5,6-tetrafluorobenzene |
| SMILES | C=Cc1c(F)c(F)c(F)c(OCC(F)F)c1F |
| InChI | InChI=1S/C10H6F6O/c1-2-4-6(13)8(15)9(16)10(7(4)14)17-3-5(11)12/h2,5H,1,3H2 |
| InChIKey | FJTCUKRHODXVJA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|