C8H4F6O2 — CID 89344987
3-(2,2-difluoroethoxy)-2,4,5,6-tetrafluorophenol (PubChem CID 89344987) has the molecular formula C8H4F6O2 and a molecular weight of 246.11 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-2,4,5,6-tetrafluorophenol.
| Compound Name | 3-(2,2-difluoroethoxy)-2,4,5,6-tetrafluorophenol |
|---|---|
| PubChem CID | 89344987 |
| Molecular Formula | C8H4F6O2 |
| Molecular Weight | 246.11 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-2,4,5,6-tetrafluorophenol |
| SMILES | Oc1c(F)c(F)c(F)c(OCC(F)F)c1F |
| InChI | InChI=1S/C8H4F6O2/c9-2(10)1-16-8-5(13)3(11)4(12)7(15)6(8)14/h2,15H,1H2 |
| InChIKey | PBEMUXBEELRKEX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.11 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|