About (2R,6S)-4-(5-chlorothiophen-2-yl)sulfonyl-2,6-dimethylmorpholine
(2R,6S)-4-(5-chlorothiophen-2-yl)sulfonyl-2,6-dimethylmorpholine (PubChem CID 893450) has the molecular formula C10H14ClNO3S2
and a molecular weight of 295.81 g/mol. Its IUPAC name is (2R,6S)-4-(5-chlorothiophen-2-yl)sulfonyl-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | (2R,6S)-4-(5-chlorothiophen-2-yl)sulfonyl-2,6-dimethylmorpholine |
| PubChem CID | 893450 |
| Molecular Formula | C10H14ClNO3S2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | (2R,6S)-4-(5-chlorothiophen-2-yl)sulfonyl-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2ccc(Cl)s2)C[C@H](C)O1 |
| InChI | InChI=1S/C10H14ClNO3S2/c1-7-5-12(6-8(2)15-7)17(13,14)10-4-3-9(11)16-10/h3-4,7-8H,5-6H2,1-2H3/t7-,8+ |
| InChIKey | DTBWRVFIYFOPKO-OCAPTIKFSA-N |
| XLogP | 2.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R,6S)-4-(5-chlorothiophen-2-yl)sulfonyl-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-4-(5-chlorothiophen-2-yl)sulfonyl-2,6-dimethylmorpholine?
The IUPAC name of (2R,6S)-4-(5-chlorothiophen-2-yl)sulfonyl-2,6-dimethylmorpholine (CID 893450) is (2R,6S)-4-(5-chlorothiophen-2-yl)sulfonyl-2,6-dimethylmorpholine.
What is the SMILES notation for (2R,6S)-4-(5-chlorothiophen-2-yl)sulfonyl-2,6-dimethylmorpholine?
The canonical SMILES for (2R,6S)-4-(5-chlorothiophen-2-yl)sulfonyl-2,6-dimethylmorpholine is C[C@@H]1CN(S(=O)(=O)c2ccc(Cl)s2)C[C@H](C)O1.
What is the InChIKey of (2R,6S)-4-(5-chlorothiophen-2-yl)sulfonyl-2,6-dimethylmorpholine?
The InChIKey is DTBWRVFIYFOPKO-OCAPTIKFSA-N. The full InChI is InChI=1S/C10H14ClNO3S2/c1-7-5-12(6-8(2)15-7)17(13,14)10-4-3-9(11)16-10/h3-4,7-8H,5-6H2,1-2H3/t7-,8+.
What are the key properties of (2R,6S)-4-(5-chlorothiophen-2-yl)sulfonyl-2,6-dimethylmorpholine?
(2R,6S)-4-(5-chlorothiophen-2-yl)sulfonyl-2,6-dimethylmorpholine has a molecular weight of 295.81 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-4-(5-chlorothiophen-2-yl)sulfonyl-2,6-dimethylmorpholine is sourced from PubChem (CID 893450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).