C12H10F8O3 — CID 89345079
2-[2-(3,3-difluoro-2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxyacetic acid (PubChem CID 89345079) has the molecular formula C12H10F8O3 and a molecular weight of 354.19 g/mol. Its IUPAC name is 2-[2-(3,3-difluoro-2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxyacetic acid.
| Compound Name | 2-[2-(3,3-difluoro-2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxyacetic acid |
|---|---|
| PubChem CID | 89345079 |
| Molecular Formula | C12H10F8O3 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 2-[2-(3,3-difluoro-2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxyacetic acid |
| SMILES | O=C(O)COC(C1C2C=CC(C2)C1(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H10F8O3/c13-9(14)6-2-1-5(3-6)8(9)10(11(15,16)17,12(18,19)20)23-4-7(21)22/h1-2,5-6,8H,3-4H2,(H,21,22) |
| InChIKey | NRPOBBBIZHGAMA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|