C22H44S2 — CID 89345082
1-tert-butylsulfanyl-5-(4,4-dimethyl-2-methylidenehexyl)sulfanyl-3,3,5-trimethylhexane (PubChem CID 89345082) has the molecular formula C22H44S2 and a molecular weight of 372.73 g/mol. Its IUPAC name is 1-tert-butylsulfanyl-5-(4,4-dimethyl-2-methylidenehexyl)sulfanyl-3,3,5-trimethylhexane.
| Compound Name | 1-tert-butylsulfanyl-5-(4,4-dimethyl-2-methylidenehexyl)sulfanyl-3,3,5-trimethylhexane |
|---|---|
| PubChem CID | 89345082 |
| Molecular Formula | C22H44S2 |
| Molecular Weight | 372.73 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | 1-tert-butylsulfanyl-5-(4,4-dimethyl-2-methylidenehexyl)sulfanyl-3,3,5-trimethylhexane |
| SMILES | C=C(CSC(C)(C)CC(C)(C)CCSC(C)(C)C)CC(C)(C)CC |
| InChI | InChI=1S/C22H44S2/c1-12-20(6,7)15-18(2)16-24-22(10,11)17-21(8,9)13-14-23-19(3,4)5/h2,12-17H2,1,3-11H3 |
| InChIKey | KXYKJQQOCXQBQB-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.73 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|