C32H68N4O — CID 89345127
3-methyl-3-[[5-methyl-5-[[(Z)-4-[[3-methyl-7-(3-methylpentan-3-ylamino)heptan-3-yl]amino]but-2-enyl]amino]heptyl]amino]pentan-1-ol (PubChem CID 89345127) has the molecular formula C32H68N4O and a molecular weight of 524.92 g/mol. Its IUPAC name is 3-methyl-3-[[5-methyl-5-[[(Z)-4-[[3-methyl-7-(3-methylpentan-3-ylamino)heptan-3-yl]amino]but-2-enyl]amino]heptyl]amino]pentan-1-ol.
| Compound Name | 3-methyl-3-[[5-methyl-5-[[(Z)-4-[[3-methyl-7-(3-methylpentan-3-ylamino)heptan-3-yl]amino]but-2-enyl]amino]heptyl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 89345127 |
| Molecular Formula | C32H68N4O |
| Molecular Weight | 524.92 g/mol |
| Exact Mass | 524.54 |
| IUPAC Name | 3-methyl-3-[[5-methyl-5-[[(Z)-4-[[3-methyl-7-(3-methylpentan-3-ylamino)heptan-3-yl]amino]but-2-enyl]amino]heptyl]amino]pentan-1-ol |
| SMILES | CCC(C)(CC)NCCCCC(C)(CC)NC/C=C\CNC(C)(CC)CCCCNC(C)(CC)CCO |
| InChI | InChI=1S/C32H68N4O/c1-10-29(6,11-2)33-24-17-15-21-30(7,12-3)34-26-19-20-27-35-31(8,13-4)22-16-18-25-36-32(9,14-5)23-28-37/h19-20,33-37H,10-18,21-28H2,1-9H3/b20-19- |
| InChIKey | HJWZETXXVFTOPU-VXPUYCOJSA-N |
| XLogP | 6.71 |
| TPSA | 68.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.92 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|