About [ethyl(sulfanylidene)-λ6-sulfanylidyne]borane
[ethyl(sulfanylidene)-λ6-sulfanylidyne]borane (PubChem CID 89345371) has the molecular formula C2H5BS2
and a molecular weight of 104.01 g/mol. Its IUPAC name is [ethyl(sulfanylidene)-λ6-sulfanylidyne]borane.
Molecular Properties
| Compound Name | [ethyl(sulfanylidene)-λ6-sulfanylidyne]borane |
| PubChem CID | 89345371 |
| Molecular Formula | C2H5BS2 |
| Molecular Weight | 104.01 g/mol |
| Exact Mass | 103.99 |
| IUPAC Name | [ethyl(sulfanylidene)-λ6-sulfanylidyne]borane |
| SMILES | B#S(=S)CC |
| InChI | InChI=1S/C2H5BS2/c1-2-5(3)4/h2H2,1H3 |
| InChIKey | LUBLZKZHVKSKEL-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.01 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [ethyl(sulfanylidene)-λ6-sulfanylidyne]borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethyl(sulfanylidene)-λ6-sulfanylidyne]borane?
The IUPAC name of [ethyl(sulfanylidene)-λ6-sulfanylidyne]borane (CID 89345371) is [ethyl(sulfanylidene)-λ6-sulfanylidyne]borane.
What is the SMILES notation for [ethyl(sulfanylidene)-λ6-sulfanylidyne]borane?
The canonical SMILES for [ethyl(sulfanylidene)-λ6-sulfanylidyne]borane is B#S(=S)CC.
What is the InChIKey of [ethyl(sulfanylidene)-λ6-sulfanylidyne]borane?
The InChIKey is LUBLZKZHVKSKEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5BS2/c1-2-5(3)4/h2H2,1H3.
What are the key properties of [ethyl(sulfanylidene)-λ6-sulfanylidyne]borane?
[ethyl(sulfanylidene)-λ6-sulfanylidyne]borane has a molecular weight of 104.01 g/mol, XLogP of 0.17, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [ethyl(sulfanylidene)-λ6-sulfanylidyne]borane is sourced from PubChem (CID 89345371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).