C25H50O5Si2 — CID 89345738
(2E)-2-[(3R,4Z,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-4-[3-(methoxymethoxy)propylidene]cyclohexylidene]ethanol (PubChem CID 89345738) has the molecular formula C25H50O5Si2 and a molecular weight of 486.84 g/mol. Its IUPAC name is (2E)-2-[(3R,4Z,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-4-[3-(methoxymethoxy)propylidene]cyclohexylidene]ethanol.
| Compound Name | (2E)-2-[(3R,4Z,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-4-[3-(methoxymethoxy)propylidene]cyclohexylidene]ethanol |
|---|---|
| PubChem CID | 89345738 |
| Molecular Formula | C25H50O5Si2 |
| Molecular Weight | 486.84 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | (2E)-2-[(3R,4Z,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-4-[3-(methoxymethoxy)propylidene]cyclohexylidene]ethanol |
| SMILES | COCOCC/C=C1/[C@H](CC(C)(C)[Si](C)(C)O)C/C(=C\CO)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H50O5Si2/c1-24(2,3)32(9,10)30-23-17-20(13-14-26)16-21(18-25(4,5)31(7,8)27)22(23)12-11-15-29-19-28-6/h12-13,21,23,26-27H,11,14-19H2,1-10H3/b20-13+,22-12-/t21-,23+/m0/s1 |
| InChIKey | UNRYGCNWDPJOHI-OOSKYIRLSA-N |
| XLogP | 6.01 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.84 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|