C10H15F6NO2S2 — CID 89345835
3-(azocan-1-ylsulfonyl)-1,1,2,2,3,3-hexafluoropropane-1-thiol (PubChem CID 89345835) has the molecular formula C10H15F6NO2S2 and a molecular weight of 359.36 g/mol. Its IUPAC name is 3-(azocan-1-ylsulfonyl)-1,1,2,2,3,3-hexafluoropropane-1-thiol.
| Compound Name | 3-(azocan-1-ylsulfonyl)-1,1,2,2,3,3-hexafluoropropane-1-thiol |
|---|---|
| PubChem CID | 89345835 |
| Molecular Formula | C10H15F6NO2S2 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 3-(azocan-1-ylsulfonyl)-1,1,2,2,3,3-hexafluoropropane-1-thiol |
| SMILES | O=S(=O)(N1CCCCCCC1)C(F)(F)C(F)(F)C(F)(F)S |
| InChI | InChI=1S/C10H15F6NO2S2/c11-8(12,9(13,14)20)10(15,16)21(18,19)17-6-4-2-1-3-5-7-17/h20H,1-7H2 |
| InChIKey | RTQZVLWOCULZJO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|