About 6-amino-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione
6-amino-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 8934584) has the molecular formula C9H10N4O2
and a molecular weight of 206.21 g/mol. Its IUPAC name is 6-amino-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-amino-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione |
| PubChem CID | 8934584 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 6-amino-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)c2cc(N)cnc2n(C)c1=O |
| InChI | InChI=1S/C9H10N4O2/c1-12-7-6(3-5(10)4-11-7)8(14)13(2)9(12)15/h3-4H,10H2,1-2H3 |
| InChIKey | QMVIEYMSZVOYRQ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-amino-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione?
The IUPAC name of 6-amino-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione (CID 8934584) is 6-amino-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione.
What is the SMILES notation for 6-amino-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione?
The canonical SMILES for 6-amino-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione is Cn1c(=O)c2cc(N)cnc2n(C)c1=O.
What is the InChIKey of 6-amino-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione?
The InChIKey is QMVIEYMSZVOYRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c1-12-7-6(3-5(10)4-11-7)8(14)13(2)9(12)15/h3-4H,10H2,1-2H3.
What are the key properties of 6-amino-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione?
6-amino-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione has a molecular weight of 206.21 g/mol, XLogP of -0.79, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione is sourced from PubChem (CID 8934584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).