About 4-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1,3-oxazolidin-2-one
4-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1,3-oxazolidin-2-one (PubChem CID 89346252) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 4-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 4-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1,3-oxazolidin-2-one |
| PubChem CID | 89346252 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 4-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1,3-oxazolidin-2-one |
| SMILES | C=C/C(=C\C)C1OC(=O)NC1C |
| InChI | InChI=1S/C9H13NO2/c1-4-7(5-2)8-6(3)10-9(11)12-8/h4-6,8H,1H2,2-3H3,(H,10,11)/b7-5+ |
| InChIKey | GBZNPTQZGJWUOX-FNORWQNLSA-N |
| XLogP | 1.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1,3-oxazolidin-2-one?
The IUPAC name of 4-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1,3-oxazolidin-2-one (CID 89346252) is 4-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 4-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1,3-oxazolidin-2-one?
The canonical SMILES for 4-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1,3-oxazolidin-2-one is C=C/C(=C\C)C1OC(=O)NC1C.
What is the InChIKey of 4-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1,3-oxazolidin-2-one?
The InChIKey is GBZNPTQZGJWUOX-FNORWQNLSA-N. The full InChI is InChI=1S/C9H13NO2/c1-4-7(5-2)8-6(3)10-9(11)12-8/h4-6,8H,1H2,2-3H3,(H,10,11)/b7-5+.
What are the key properties of 4-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1,3-oxazolidin-2-one?
4-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1,3-oxazolidin-2-one has a molecular weight of 167.21 g/mol, XLogP of 1.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 89346252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).