About 1-iodo-N,N,3-trimethylbut-2-en-2-amine
1-iodo-N,N,3-trimethylbut-2-en-2-amine (PubChem CID 89346313) has the molecular formula C7H14IN
and a molecular weight of 239.10 g/mol. Its IUPAC name is 1-iodo-N,N,3-trimethylbut-2-en-2-amine.
Molecular Properties
| Compound Name | 1-iodo-N,N,3-trimethylbut-2-en-2-amine |
| PubChem CID | 89346313 |
| Molecular Formula | C7H14IN |
| Molecular Weight | 239.10 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 1-iodo-N,N,3-trimethylbut-2-en-2-amine |
| SMILES | CC(C)=C(CI)N(C)C |
| InChI | InChI=1S/C7H14IN/c1-6(2)7(5-8)9(3)4/h5H2,1-4H3 |
| InChIKey | MOQNOZIZXSUZCF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.10 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-N,N,3-trimethylbut-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-N,N,3-trimethylbut-2-en-2-amine?
The IUPAC name of 1-iodo-N,N,3-trimethylbut-2-en-2-amine (CID 89346313) is 1-iodo-N,N,3-trimethylbut-2-en-2-amine.
What is the SMILES notation for 1-iodo-N,N,3-trimethylbut-2-en-2-amine?
The canonical SMILES for 1-iodo-N,N,3-trimethylbut-2-en-2-amine is CC(C)=C(CI)N(C)C.
What is the InChIKey of 1-iodo-N,N,3-trimethylbut-2-en-2-amine?
The InChIKey is MOQNOZIZXSUZCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14IN/c1-6(2)7(5-8)9(3)4/h5H2,1-4H3.
What are the key properties of 1-iodo-N,N,3-trimethylbut-2-en-2-amine?
1-iodo-N,N,3-trimethylbut-2-en-2-amine has a molecular weight of 239.10 g/mol, XLogP of 2.28, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-N,N,3-trimethylbut-2-en-2-amine is sourced from PubChem (CID 89346313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).