About 3-propan-2-ylthieno[3,4-b]thiophene
3-propan-2-ylthieno[3,4-b]thiophene (PubChem CID 89346622) has the molecular formula C9H10S2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 3-propan-2-ylthieno[3,4-b]thiophene.
Molecular Properties
| Compound Name | 3-propan-2-ylthieno[3,4-b]thiophene |
| PubChem CID | 89346622 |
| Molecular Formula | C9H10S2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 3-propan-2-ylthieno[3,4-b]thiophene |
| SMILES | CC(C)c1csc2cscc12 |
| InChI | InChI=1S/C9H10S2/c1-6(2)7-4-11-9-5-10-3-8(7)9/h3-6H,1-2H3 |
| InChIKey | HJAPZEMFYSSIDI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propan-2-ylthieno[3,4-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-ylthieno[3,4-b]thiophene?
The IUPAC name of 3-propan-2-ylthieno[3,4-b]thiophene (CID 89346622) is 3-propan-2-ylthieno[3,4-b]thiophene.
What is the SMILES notation for 3-propan-2-ylthieno[3,4-b]thiophene?
The canonical SMILES for 3-propan-2-ylthieno[3,4-b]thiophene is CC(C)c1csc2cscc12.
What is the InChIKey of 3-propan-2-ylthieno[3,4-b]thiophene?
The InChIKey is HJAPZEMFYSSIDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10S2/c1-6(2)7-4-11-9-5-10-3-8(7)9/h3-6H,1-2H3.
What are the key properties of 3-propan-2-ylthieno[3,4-b]thiophene?
3-propan-2-ylthieno[3,4-b]thiophene has a molecular weight of 182.31 g/mol, XLogP of 4.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-ylthieno[3,4-b]thiophene is sourced from PubChem (CID 89346622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).