C12H19N — CID 89346875
5,5-dimethyl-1,2,3,4,5a,6-hexahydro-1-benzazepine (PubChem CID 89346875) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 5,5-dimethyl-1,2,3,4,5a,6-hexahydro-1-benzazepine.
| Compound Name | 5,5-dimethyl-1,2,3,4,5a,6-hexahydro-1-benzazepine |
|---|---|
| PubChem CID | 89346875 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 5,5-dimethyl-1,2,3,4,5a,6-hexahydro-1-benzazepine |
| SMILES | CC1(C)CCCNC2=CC=CCC21 |
| InChI | InChI=1S/C12H19N/c1-12(2)8-5-9-13-11-7-4-3-6-10(11)12/h3-4,7,10,13H,5-6,8-9H2,1-2H3 |
| InChIKey | OTDXOUGCSOYTHS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |