C14H24N2O — CID 89347279
(2S)-N-ethyl-2-(ethylamino)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]propanamide (PubChem CID 89347279) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is (2S)-N-ethyl-2-(ethylamino)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]propanamide.
| Compound Name | (2S)-N-ethyl-2-(ethylamino)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]propanamide |
|---|---|
| PubChem CID | 89347279 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | (2S)-N-ethyl-2-(ethylamino)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]propanamide |
| SMILES | C=C/C=C(\C=C/C)N(CC)C(=O)[C@H](C)NCC |
| InChI | InChI=1S/C14H24N2O/c1-6-10-13(11-7-2)16(9-4)14(17)12(5)15-8-3/h6-7,10-12,15H,1,8-9H2,2-5H3/b11-7-,13-10+/t12-/m0/s1 |
| InChIKey | YZSHKTZKJOLKEO-TUHDSVSTSA-N |
| XLogP | 2.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|