About 5,6-dichloro-1-methyl-5,6-dihydrobenzimidazole
5,6-dichloro-1-methyl-5,6-dihydrobenzimidazole (PubChem CID 89347396) has the molecular formula C8H8Cl2N2
and a molecular weight of 203.07 g/mol. Its IUPAC name is 5,6-dichloro-1-methyl-5,6-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 5,6-dichloro-1-methyl-5,6-dihydrobenzimidazole |
| PubChem CID | 89347396 |
| Molecular Formula | C8H8Cl2N2 |
| Molecular Weight | 203.07 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 5,6-dichloro-1-methyl-5,6-dihydrobenzimidazole |
| SMILES | Cn1cnc2c1=CC(Cl)C(Cl)C=2 |
| InChI | InChI=1S/C8H8Cl2N2/c1-12-4-11-7-2-5(9)6(10)3-8(7)12/h2-6H,1H3 |
| InChIKey | RZIQGWSCZWYQTF-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.07 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dichloro-1-methyl-5,6-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-1-methyl-5,6-dihydrobenzimidazole?
The IUPAC name of 5,6-dichloro-1-methyl-5,6-dihydrobenzimidazole (CID 89347396) is 5,6-dichloro-1-methyl-5,6-dihydrobenzimidazole.
What is the SMILES notation for 5,6-dichloro-1-methyl-5,6-dihydrobenzimidazole?
The canonical SMILES for 5,6-dichloro-1-methyl-5,6-dihydrobenzimidazole is Cn1cnc2c1=CC(Cl)C(Cl)C=2.
What is the InChIKey of 5,6-dichloro-1-methyl-5,6-dihydrobenzimidazole?
The InChIKey is RZIQGWSCZWYQTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2N2/c1-12-4-11-7-2-5(9)6(10)3-8(7)12/h2-6H,1H3.
What are the key properties of 5,6-dichloro-1-methyl-5,6-dihydrobenzimidazole?
5,6-dichloro-1-methyl-5,6-dihydrobenzimidazole has a molecular weight of 203.07 g/mol, XLogP of 0.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-1-methyl-5,6-dihydrobenzimidazole is sourced from PubChem (CID 89347396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).