C13H21N6+ — CID 89347504
N'-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]cyclohexa-2,4-dien-1-yl]ethane-1,2-diamine (PubChem CID 89347504) has the molecular formula C13H21N6+ and a molecular weight of 261.35 g/mol. Its IUPAC name is N'-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]cyclohexa-2,4-dien-1-yl]ethane-1,2-diamine.
| Compound Name | N'-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]cyclohexa-2,4-dien-1-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 89347504 |
| Molecular Formula | C13H21N6+ |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | N'-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]cyclohexa-2,4-dien-1-yl]ethane-1,2-diamine |
| SMILES | Cn1cc[n+](C)c1/N=N/C1=CCC(NCCN)C=C1 |
| InChI | InChI=1S/C13H21N6/c1-18-9-10-19(2)13(18)17-16-12-5-3-11(4-6-12)15-8-7-14/h3,5-6,9-11,15H,4,7-8,14H2,1-2H3/q+1 |
| InChIKey | KOCOQKDWIJQXDT-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|