2-[3-(2-hydroxypropoxy)propylsulfanyl]acetic acid

C8H16O4S — CID 89347580

IUPAC2-[3-(2-hydroxypropoxy)propylsulfanyl]acetic acid
SMILESCC(O)COCCCSCC(=O)O
InChIInChI=1S/C8H16O4S/c1-7(9)5-12-3-2-4-13-6-8(10)11/h7,9H,2-6H2,1H3,(H,10,11)
InChIKeyIGGJJNNZLBYXOV-UHFFFAOYSA-N
MW208.28 g/mol
LogP0.59
Rot. Bonds8

About 2-[3-(2-hydroxypropoxy)propylsulfanyl]acetic acid

2-[3-(2-hydroxypropoxy)propylsulfanyl]acetic acid (PubChem CID 89347580) has the molecular formula C8H16O4S and a molecular weight of 208.28 g/mol. Its IUPAC name is 2-[3-(2-hydroxypropoxy)propylsulfanyl]acetic acid.

Molecular Properties

Compound Name2-[3-(2-hydroxypropoxy)propylsulfanyl]acetic acid
PubChem CID89347580
Molecular FormulaC8H16O4S
Molecular Weight208.28 g/mol
Exact Mass208.08
IUPAC Name2-[3-(2-hydroxypropoxy)propylsulfanyl]acetic acid
SMILESCC(O)COCCCSCC(=O)O
InChIInChI=1S/C8H16O4S/c1-7(9)5-12-3-2-4-13-6-8(10)11/h7,9H,2-6H2,1H3,(H,10,11)
InChIKeyIGGJJNNZLBYXOV-UHFFFAOYSA-N
XLogP0.59
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.28
LogP ≤ 50.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[3-(2-hydroxypropoxy)propylsulfanyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(2-hydroxypropoxy)propylsulfanyl]acetic acid?
The IUPAC name of 2-[3-(2-hydroxypropoxy)propylsulfanyl]acetic acid (CID 89347580) is 2-[3-(2-hydroxypropoxy)propylsulfanyl]acetic acid.
What is the SMILES notation for 2-[3-(2-hydroxypropoxy)propylsulfanyl]acetic acid?
The canonical SMILES for 2-[3-(2-hydroxypropoxy)propylsulfanyl]acetic acid is CC(O)COCCCSCC(=O)O.
What is the InChIKey of 2-[3-(2-hydroxypropoxy)propylsulfanyl]acetic acid?
The InChIKey is IGGJJNNZLBYXOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O4S/c1-7(9)5-12-3-2-4-13-6-8(10)11/h7,9H,2-6H2,1H3,(H,10,11).
What are the key properties of 2-[3-(2-hydroxypropoxy)propylsulfanyl]acetic acid?
2-[3-(2-hydroxypropoxy)propylsulfanyl]acetic acid has a molecular weight of 208.28 g/mol, XLogP of 0.59, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-hydroxypropoxy)propylsulfanyl]acetic acid is sourced from PubChem (CID 89347580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).