C15H23F3O9S — CID 89347742
methyl 2-(6-butoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-(trifluoromethylsulfonyloxy)acetate (PubChem CID 89347742) has the molecular formula C15H23F3O9S and a molecular weight of 436.40 g/mol. Its IUPAC name is methyl 2-(6-butoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-(trifluoromethylsulfonyloxy)acetate.
| Compound Name | methyl 2-(6-butoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-(trifluoromethylsulfonyloxy)acetate |
|---|---|
| PubChem CID | 89347742 |
| Molecular Formula | C15H23F3O9S |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | methyl 2-(6-butoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-(trifluoromethylsulfonyloxy)acetate |
| SMILES | CCCCOC1C2OC(C)(C)OC2OC1C(OS(=O)(=O)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C15H23F3O9S/c1-5-6-7-23-8-9(24-13-11(8)25-14(2,3)26-13)10(12(19)22-4)27-28(20,21)15(16,17)18/h8-11,13H,5-7H2,1-4H3 |
| InChIKey | SZARHQZWRFPCBA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|