About 2-(2,3-dihydrothiophen-2-yl)-3,3-dimethyloxetane
2-(2,3-dihydrothiophen-2-yl)-3,3-dimethyloxetane (PubChem CID 89347759) has the molecular formula C9H14OS
and a molecular weight of 170.28 g/mol. Its IUPAC name is 2-(2,3-dihydrothiophen-2-yl)-3,3-dimethyloxetane.
Molecular Properties
| Compound Name | 2-(2,3-dihydrothiophen-2-yl)-3,3-dimethyloxetane |
| PubChem CID | 89347759 |
| Molecular Formula | C9H14OS |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 2-(2,3-dihydrothiophen-2-yl)-3,3-dimethyloxetane |
| SMILES | CC1(C)COC1C1CC=CS1 |
| InChI | InChI=1S/C9H14OS/c1-9(2)6-10-8(9)7-4-3-5-11-7/h3,5,7-8H,4,6H2,1-2H3 |
| InChIKey | YORATCDTQNRQGD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,3-dihydrothiophen-2-yl)-3,3-dimethyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydrothiophen-2-yl)-3,3-dimethyloxetane?
The IUPAC name of 2-(2,3-dihydrothiophen-2-yl)-3,3-dimethyloxetane (CID 89347759) is 2-(2,3-dihydrothiophen-2-yl)-3,3-dimethyloxetane.
What is the SMILES notation for 2-(2,3-dihydrothiophen-2-yl)-3,3-dimethyloxetane?
The canonical SMILES for 2-(2,3-dihydrothiophen-2-yl)-3,3-dimethyloxetane is CC1(C)COC1C1CC=CS1.
What is the InChIKey of 2-(2,3-dihydrothiophen-2-yl)-3,3-dimethyloxetane?
The InChIKey is YORATCDTQNRQGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14OS/c1-9(2)6-10-8(9)7-4-3-5-11-7/h3,5,7-8H,4,6H2,1-2H3.
What are the key properties of 2-(2,3-dihydrothiophen-2-yl)-3,3-dimethyloxetane?
2-(2,3-dihydrothiophen-2-yl)-3,3-dimethyloxetane has a molecular weight of 170.28 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydrothiophen-2-yl)-3,3-dimethyloxetane is sourced from PubChem (CID 89347759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).