C23H26FNO — CID 89347905
(5E)-5-[(3Z,5E,7Z)-4-amino-5-ethylnona-3,5,7-trien-2-ylidene]-3-(3-fluorophenyl)cyclohexa-1,3-dien-1-ol (PubChem CID 89347905) has the molecular formula C23H26FNO and a molecular weight of 351.47 g/mol. Its IUPAC name is (5E)-5-[(3Z,5E,7Z)-4-amino-5-ethylnona-3,5,7-trien-2-ylidene]-3-(3-fluorophenyl)cyclohexa-1,3-dien-1-ol.
| Compound Name | (5E)-5-[(3Z,5E,7Z)-4-amino-5-ethylnona-3,5,7-trien-2-ylidene]-3-(3-fluorophenyl)cyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 89347905 |
| Molecular Formula | C23H26FNO |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | (5E)-5-[(3Z,5E,7Z)-4-amino-5-ethylnona-3,5,7-trien-2-ylidene]-3-(3-fluorophenyl)cyclohexa-1,3-dien-1-ol |
| SMILES | C/C=C\C=C(CC)\C(N)=C\C(C)=C1\C=C(c2cccc(F)c2)C=C(O)C1 |
| InChI | InChI=1S/C23H26FNO/c1-4-6-8-17(5-2)23(25)11-16(3)19-12-20(15-22(26)14-19)18-9-7-10-21(24)13-18/h4,6-13,15,26H,5,14,25H2,1-3H3/b6-4-,17-8+,19-16-,23-11- |
| InChIKey | OPUCNDXQGLFZTB-SHWBNQRPSA-N |
| XLogP | 6.13 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|