About 2-(dimethylamino)-N-(5-ethyl-1,3-oxazol-2-yl)acetamide
2-(dimethylamino)-N-(5-ethyl-1,3-oxazol-2-yl)acetamide (PubChem CID 89347935) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-(dimethylamino)-N-(5-ethyl-1,3-oxazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(dimethylamino)-N-(5-ethyl-1,3-oxazol-2-yl)acetamide |
| PubChem CID | 89347935 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-(dimethylamino)-N-(5-ethyl-1,3-oxazol-2-yl)acetamide |
| SMILES | CCc1cnc(NC(=O)CN(C)C)o1 |
| InChI | InChI=1S/C9H15N3O2/c1-4-7-5-10-9(14-7)11-8(13)6-12(2)3/h5H,4,6H2,1-3H3,(H,10,11,13) |
| InChIKey | FDDIFXRORQHKEU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(dimethylamino)-N-(5-ethyl-1,3-oxazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-N-(5-ethyl-1,3-oxazol-2-yl)acetamide?
The IUPAC name of 2-(dimethylamino)-N-(5-ethyl-1,3-oxazol-2-yl)acetamide (CID 89347935) is 2-(dimethylamino)-N-(5-ethyl-1,3-oxazol-2-yl)acetamide.
What is the SMILES notation for 2-(dimethylamino)-N-(5-ethyl-1,3-oxazol-2-yl)acetamide?
The canonical SMILES for 2-(dimethylamino)-N-(5-ethyl-1,3-oxazol-2-yl)acetamide is CCc1cnc(NC(=O)CN(C)C)o1.
What is the InChIKey of 2-(dimethylamino)-N-(5-ethyl-1,3-oxazol-2-yl)acetamide?
The InChIKey is FDDIFXRORQHKEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2/c1-4-7-5-10-9(14-7)11-8(13)6-12(2)3/h5H,4,6H2,1-3H3,(H,10,11,13).
What are the key properties of 2-(dimethylamino)-N-(5-ethyl-1,3-oxazol-2-yl)acetamide?
2-(dimethylamino)-N-(5-ethyl-1,3-oxazol-2-yl)acetamide has a molecular weight of 197.24 g/mol, XLogP of 0.74, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-N-(5-ethyl-1,3-oxazol-2-yl)acetamide is sourced from PubChem (CID 89347935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).