C24H30F3NO4 — CID 89348110
benzyl (1S,4S)-4-[(3-methyloxan-4-yl)-(2,2,2-trifluoroacetyl)amino]-1-propan-2-ylcyclopent-2-ene-1-carboxylate (PubChem CID 89348110) has the molecular formula C24H30F3NO4 and a molecular weight of 453.50 g/mol. Its IUPAC name is benzyl (1S,4S)-4-[(3-methyloxan-4-yl)-(2,2,2-trifluoroacetyl)amino]-1-propan-2-ylcyclopent-2-ene-1-carboxylate.
| Compound Name | benzyl (1S,4S)-4-[(3-methyloxan-4-yl)-(2,2,2-trifluoroacetyl)amino]-1-propan-2-ylcyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 89348110 |
| Molecular Formula | C24H30F3NO4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | benzyl (1S,4S)-4-[(3-methyloxan-4-yl)-(2,2,2-trifluoroacetyl)amino]-1-propan-2-ylcyclopent-2-ene-1-carboxylate |
| SMILES | CC1COCCC1N(C(=O)C(F)(F)F)[C@@H]1C=C[C@@](C(=O)OCc2ccccc2)(C(C)C)C1 |
| InChI | InChI=1S/C24H30F3NO4/c1-16(2)23(22(30)32-15-18-7-5-4-6-8-18)11-9-19(13-23)28(21(29)24(25,26)27)20-10-12-31-14-17(20)3/h4-9,11,16-17,19-20H,10,12-15H2,1-3H3/t17?,19-,20?,23+/m1/s1 |
| InChIKey | IDDYTZBFDJJPMA-BWLPEJSISA-N |
| XLogP | 4.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|