C27H29FN2O2 — CID 89348161
N-[2-[6-(2-fluorophenyl)-2-[(3E,5Z)-hepta-3,5-dien-3-yl]-4-methylquinolin-8-yl]oxyethyl]acetamide (PubChem CID 89348161) has the molecular formula C27H29FN2O2 and a molecular weight of 432.54 g/mol. Its IUPAC name is N-[2-[6-(2-fluorophenyl)-2-[(3E,5Z)-hepta-3,5-dien-3-yl]-4-methylquinolin-8-yl]oxyethyl]acetamide.
| Compound Name | N-[2-[6-(2-fluorophenyl)-2-[(3E,5Z)-hepta-3,5-dien-3-yl]-4-methylquinolin-8-yl]oxyethyl]acetamide |
|---|---|
| PubChem CID | 89348161 |
| Molecular Formula | C27H29FN2O2 |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | N-[2-[6-(2-fluorophenyl)-2-[(3E,5Z)-hepta-3,5-dien-3-yl]-4-methylquinolin-8-yl]oxyethyl]acetamide |
| SMILES | C/C=C\C=C(/CC)c1cc(C)c2cc(-c3ccccc3F)cc(OCCNC(C)=O)c2n1 |
| InChI | InChI=1S/C27H29FN2O2/c1-5-7-10-20(6-2)25-15-18(3)23-16-21(22-11-8-9-12-24(22)28)17-26(27(23)30-25)32-14-13-29-19(4)31/h5,7-12,15-17H,6,13-14H2,1-4H3,(H,29,31)/b7-5-,20-10+ |
| InChIKey | YNAYZLQOAPKIAI-IYJRJDJBSA-N |
| XLogP | 6.23 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|