C19H25NO6 — CID 89348938
(2R,4S,5S)-2-[ethoxy(naphthalen-2-ylmethyl)amino]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 89348938) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is (2R,4S,5S)-2-[ethoxy(naphthalen-2-ylmethyl)amino]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,4S,5S)-2-[ethoxy(naphthalen-2-ylmethyl)amino]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 89348938 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | (2R,4S,5S)-2-[ethoxy(naphthalen-2-ylmethyl)amino]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCON(Cc1ccc2ccccc2c1)[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C19H25NO6/c1-2-25-20(19-18(24)17(23)16(22)15(11-21)26-19)10-12-7-8-13-5-3-4-6-14(13)9-12/h3-9,15-19,21-24H,2,10-11H2,1H3/t15?,16-,17+,18?,19-/m1/s1 |
| InChIKey | VIRDSFCWMDWJIX-YKZJBZHWSA-N |
| XLogP | 0.39 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|