C43H45BF4N8O14S — CID 89349043
CID 89349043 (PubChem CID 89349043) has the molecular formula C43H45BF4N8O14S and a molecular weight of 1016.75 g/mol.
| Compound Name | CID 89349043 |
|---|---|
| PubChem CID | 89349043 |
| Molecular Formula | C43H45BF4N8O14S |
| Molecular Weight | 1016.75 g/mol |
| Exact Mass | 1016.28 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(S(=O)(=O)N[C@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)NCC(=O)N[C@@H](Cc2cccc(F)c2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N[C@@H](CCC(=O)O)C(N)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C43H45BF4N8O14S/c44-27-9-8-24(17-26(27)43(46,47)48)71(69,70)56-33(18-37(62)63)42(68)54-30(11-13-36(60)61)39(65)51-20-34(57)52-31(15-21-4-3-5-23(45)14-21)40(66)55-32(16-22-19-50-28-7-2-1-6-25(22)28)41(67)53-29(38(49)64)10-12-35(58)59/h1-9,14,17,19,29-33,50,56H,10-13,15-16,18,20H2,(H2,49,64)(H,51,65)(H,52,57)(H,53,67)(H,54,68)(H,55,66)(H,58,59)(H,60,61)(H,62,63)/t29-,30-,31-,32-,33+/m0/s1 |
| InChIKey | IIFPLIYHBVCKHS-PMUGGPHNSA-N |
| XLogP | -1.00 |
| TPSA | 362.45 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1016.75 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|