C17H21FO8S — CID 89349100
[(2R)-2-[(3aR,5S,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methylsulfonyloxyethyl] benzoate (PubChem CID 89349100) has the molecular formula C17H21FO8S and a molecular weight of 404.41 g/mol. Its IUPAC name is [(2R)-2-[(3aR,5S,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methylsulfonyloxyethyl] benzoate.
| Compound Name | [(2R)-2-[(3aR,5S,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methylsulfonyloxyethyl] benzoate |
|---|---|
| PubChem CID | 89349100 |
| Molecular Formula | C17H21FO8S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | [(2R)-2-[(3aR,5S,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methylsulfonyloxyethyl] benzoate |
| SMILES | CC1(C)O[C@H]2O[C@@H]([C@@H](COC(=O)c3ccccc3)OS(C)(=O)=O)[C@H](F)[C@H]2O1 |
| InChI | InChI=1S/C17H21FO8S/c1-17(2)24-14-12(18)13(23-16(14)25-17)11(26-27(3,20)21)9-22-15(19)10-7-5-4-6-8-10/h4-8,11-14,16H,9H2,1-3H3/t11-,12+,13+,14-,16-/m1/s1 |
| InChIKey | UXPJIYTVRYLMOG-WZYWGQKZSA-N |
| XLogP | 1.40 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|