C13H19BrO5 — CID 89349198
(3S,4R)-2-[1-(2-bromophenoxy)ethoxy]pentane-1,3,4-triol (PubChem CID 89349198) has the molecular formula C13H19BrO5 and a molecular weight of 335.19 g/mol. Its IUPAC name is (3S,4R)-2-[1-(2-bromophenoxy)ethoxy]pentane-1,3,4-triol.
| Compound Name | (3S,4R)-2-[1-(2-bromophenoxy)ethoxy]pentane-1,3,4-triol |
|---|---|
| PubChem CID | 89349198 |
| Molecular Formula | C13H19BrO5 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | (3S,4R)-2-[1-(2-bromophenoxy)ethoxy]pentane-1,3,4-triol |
| SMILES | CC(Oc1ccccc1Br)OC(CO)[C@@H](O)[C@@H](C)O |
| InChI | InChI=1S/C13H19BrO5/c1-8(16)13(17)12(7-15)19-9(2)18-11-6-4-3-5-10(11)14/h3-6,8-9,12-13,15-17H,7H2,1-2H3/t8-,9?,12?,13+/m1/s1 |
| InChIKey | FPAWJVIBBMNAGW-NFNIOBPHSA-N |
| XLogP | 1.29 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|