C10H16N2 — CID 89349387
5-cyclopropyl-1,2-diethylimidazole (PubChem CID 89349387) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 5-cyclopropyl-1,2-diethylimidazole.
| Compound Name | 5-cyclopropyl-1,2-diethylimidazole |
|---|---|
| PubChem CID | 89349387 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 5-cyclopropyl-1,2-diethylimidazole |
| SMILES | CCc1ncc(C2CC2)n1CC |
| InChI | InChI=1S/C10H16N2/c1-3-10-11-7-9(8-5-6-8)12(10)4-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | JTSQTQPHYLDKOR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |