C11H19F6N2O5S2+ — CID 89349425
[1-[1,1,2,2,3,3-hexafluoro-3-(trioxidanylsulfanyl)propyl]sulfonylpiperidin-4-yl]-trimethylazanium (PubChem CID 89349425) has the molecular formula C11H19F6N2O5S2+ and a molecular weight of 437.40 g/mol. Its IUPAC name is [1-[1,1,2,2,3,3-hexafluoro-3-(trioxidanylsulfanyl)propyl]sulfonylpiperidin-4-yl]-trimethylazanium.
| Compound Name | [1-[1,1,2,2,3,3-hexafluoro-3-(trioxidanylsulfanyl)propyl]sulfonylpiperidin-4-yl]-trimethylazanium |
|---|---|
| PubChem CID | 89349425 |
| Molecular Formula | C11H19F6N2O5S2+ |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | [1-[1,1,2,2,3,3-hexafluoro-3-(trioxidanylsulfanyl)propyl]sulfonylpiperidin-4-yl]-trimethylazanium |
| SMILES | C[N+](C)(C)C1CCN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)SOOO)CC1 |
| InChI | InChI=1S/C11H18F6N2O5S2/c1-19(2,3)8-4-6-18(7-5-8)26(21,22)11(16,17)9(12,13)10(14,15)25-24-23-20/h8H,4-7H2,1-3H3/p+1 |
| InChIKey | KZSSFGXLRVVHPK-UHFFFAOYSA-O |
| XLogP | 2.38 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|