About 2,2-dihydroxy-1,3,2-dioxaphospholan-2-ium
2,2-dihydroxy-1,3,2-dioxaphospholan-2-ium (PubChem CID 89349688) has the molecular formula C2H6O4P+
and a molecular weight of 125.04 g/mol. Its IUPAC name is 2,2-dihydroxy-1,3,2-dioxaphospholan-2-ium.
Molecular Properties
| Compound Name | 2,2-dihydroxy-1,3,2-dioxaphospholan-2-ium |
| PubChem CID | 89349688 |
| Molecular Formula | C2H6O4P+ |
| Molecular Weight | 125.04 g/mol |
| Exact Mass | 125.00 |
| IUPAC Name | 2,2-dihydroxy-1,3,2-dioxaphospholan-2-ium |
| SMILES | O[P+]1(O)OCCO1 |
| InChI | InChI=1S/C2H6O4P/c3-7(4)5-1-2-6-7/h3-4H,1-2H2/q+1 |
| InChIKey | ZTIOGFUPISLZSZ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.04 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dihydroxy-1,3,2-dioxaphospholan-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dihydroxy-1,3,2-dioxaphospholan-2-ium?
The IUPAC name of 2,2-dihydroxy-1,3,2-dioxaphospholan-2-ium (CID 89349688) is 2,2-dihydroxy-1,3,2-dioxaphospholan-2-ium.
What is the SMILES notation for 2,2-dihydroxy-1,3,2-dioxaphospholan-2-ium?
The canonical SMILES for 2,2-dihydroxy-1,3,2-dioxaphospholan-2-ium is O[P+]1(O)OCCO1.
What is the InChIKey of 2,2-dihydroxy-1,3,2-dioxaphospholan-2-ium?
The InChIKey is ZTIOGFUPISLZSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6O4P/c3-7(4)5-1-2-6-7/h3-4H,1-2H2/q+1.
What are the key properties of 2,2-dihydroxy-1,3,2-dioxaphospholan-2-ium?
2,2-dihydroxy-1,3,2-dioxaphospholan-2-ium has a molecular weight of 125.04 g/mol, XLogP of -0.30, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dihydroxy-1,3,2-dioxaphospholan-2-ium is sourced from PubChem (CID 89349688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).