C13H21N3O4 — CID 89349742
N-[6-(aminooxymethyl)-2-pyridinyl]-3,3-dimethoxy-2,2-dimethylpropanamide (PubChem CID 89349742) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-[6-(aminooxymethyl)-2-pyridinyl]-3,3-dimethoxy-2,2-dimethylpropanamide.
| Compound Name | N-[6-(aminooxymethyl)-2-pyridinyl]-3,3-dimethoxy-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 89349742 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-[6-(aminooxymethyl)-2-pyridinyl]-3,3-dimethoxy-2,2-dimethylpropanamide |
| SMILES | COC(OC)C(C)(C)C(=O)Nc1cccc(CON)n1 |
| InChI | InChI=1S/C13H21N3O4/c1-13(2,12(18-3)19-4)11(17)16-10-7-5-6-9(15-10)8-20-14/h5-7,12H,8,14H2,1-4H3,(H,15,16,17) |
| InChIKey | PIGUFTMWJPWSAS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|