About (5Z,7E)-7-fluoro-2-methyl-4-methylidenenona-5,7-dien-2-amine
(5Z,7E)-7-fluoro-2-methyl-4-methylidenenona-5,7-dien-2-amine (PubChem CID 89350511) has the molecular formula C11H18FN
and a molecular weight of 183.27 g/mol. Its IUPAC name is (5Z,7E)-7-fluoro-2-methyl-4-methylidenenona-5,7-dien-2-amine.
Molecular Properties
| Compound Name | (5Z,7E)-7-fluoro-2-methyl-4-methylidenenona-5,7-dien-2-amine |
| PubChem CID | 89350511 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (5Z,7E)-7-fluoro-2-methyl-4-methylidenenona-5,7-dien-2-amine |
| SMILES | C=C(/C=C\C(F)=C/C)CC(C)(C)N |
| InChI | InChI=1S/C11H18FN/c1-5-10(12)7-6-9(2)8-11(3,4)13/h5-7H,2,8,13H2,1,3-4H3/b7-6-,10-5+ |
| InChIKey | YMOYJTWKYSNYDK-JQEGGOPCSA-N |
| XLogP | 3.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5Z,7E)-7-fluoro-2-methyl-4-methylidenenona-5,7-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,7E)-7-fluoro-2-methyl-4-methylidenenona-5,7-dien-2-amine?
The IUPAC name of (5Z,7E)-7-fluoro-2-methyl-4-methylidenenona-5,7-dien-2-amine (CID 89350511) is (5Z,7E)-7-fluoro-2-methyl-4-methylidenenona-5,7-dien-2-amine.
What is the SMILES notation for (5Z,7E)-7-fluoro-2-methyl-4-methylidenenona-5,7-dien-2-amine?
The canonical SMILES for (5Z,7E)-7-fluoro-2-methyl-4-methylidenenona-5,7-dien-2-amine is C=C(/C=C\C(F)=C/C)CC(C)(C)N.
What is the InChIKey of (5Z,7E)-7-fluoro-2-methyl-4-methylidenenona-5,7-dien-2-amine?
The InChIKey is YMOYJTWKYSNYDK-JQEGGOPCSA-N. The full InChI is InChI=1S/C11H18FN/c1-5-10(12)7-6-9(2)8-11(3,4)13/h5-7H,2,8,13H2,1,3-4H3/b7-6-,10-5+.
What are the key properties of (5Z,7E)-7-fluoro-2-methyl-4-methylidenenona-5,7-dien-2-amine?
(5Z,7E)-7-fluoro-2-methyl-4-methylidenenona-5,7-dien-2-amine has a molecular weight of 183.27 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,7E)-7-fluoro-2-methyl-4-methylidenenona-5,7-dien-2-amine is sourced from PubChem (CID 89350511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).