About (E)-3-amino-N'-[(2S)-butan-2-yl]-3-[(3R)-3-(methylamino)pyrrolidin-1-yl]prop-2-enimidamide
(E)-3-amino-N'-[(2S)-butan-2-yl]-3-[(3R)-3-(methylamino)pyrrolidin-1-yl]prop-2-enimidamide (PubChem CID 89350974) has the molecular formula C12H25N5
and a molecular weight of 239.37 g/mol. Its IUPAC name is (E)-3-amino-N'-[(2S)-butan-2-yl]-3-[(3R)-3-(methylamino)pyrrolidin-1-yl]prop-2-enimidamide.
Molecular Properties
| Compound Name | (E)-3-amino-N'-[(2S)-butan-2-yl]-3-[(3R)-3-(methylamino)pyrrolidin-1-yl]prop-2-enimidamide |
| PubChem CID | 89350974 |
| Molecular Formula | C12H25N5 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.21 |
| IUPAC Name | (E)-3-amino-N'-[(2S)-butan-2-yl]-3-[(3R)-3-(methylamino)pyrrolidin-1-yl]prop-2-enimidamide |
| SMILES | CC[C@H](C)/N=C(N)/C=C(\N)N1CC[C@@H](NC)C1 |
| InChI | InChI=1S/C12H25N5/c1-4-9(2)16-11(13)7-12(14)17-6-5-10(8-17)15-3/h7,9-10,15H,4-6,8,14H2,1-3H3,(H2,13,16)/b12-7+/t9-,10+/m0/s1 |
| InChIKey | UUOSADNVTNSJJW-RUJTVUFUSA-N |
| XLogP | 0.24 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-amino-N'-[(2S)-butan-2-yl]-3-[(3R)-3-(methylamino)pyrrolidin-1-yl]prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-amino-N'-[(2S)-butan-2-yl]-3-[(3R)-3-(methylamino)pyrrolidin-1-yl]prop-2-enimidamide?
The IUPAC name of (E)-3-amino-N'-[(2S)-butan-2-yl]-3-[(3R)-3-(methylamino)pyrrolidin-1-yl]prop-2-enimidamide (CID 89350974) is (E)-3-amino-N'-[(2S)-butan-2-yl]-3-[(3R)-3-(methylamino)pyrrolidin-1-yl]prop-2-enimidamide.
What is the SMILES notation for (E)-3-amino-N'-[(2S)-butan-2-yl]-3-[(3R)-3-(methylamino)pyrrolidin-1-yl]prop-2-enimidamide?
The canonical SMILES for (E)-3-amino-N'-[(2S)-butan-2-yl]-3-[(3R)-3-(methylamino)pyrrolidin-1-yl]prop-2-enimidamide is CC[C@H](C)/N=C(N)/C=C(\N)N1CC[C@@H](NC)C1.
What is the InChIKey of (E)-3-amino-N'-[(2S)-butan-2-yl]-3-[(3R)-3-(methylamino)pyrrolidin-1-yl]prop-2-enimidamide?
The InChIKey is UUOSADNVTNSJJW-RUJTVUFUSA-N. The full InChI is InChI=1S/C12H25N5/c1-4-9(2)16-11(13)7-12(14)17-6-5-10(8-17)15-3/h7,9-10,15H,4-6,8,14H2,1-3H3,(H2,13,16)/b12-7+/t9-,10+/m0/s1.
What are the key properties of (E)-3-amino-N'-[(2S)-butan-2-yl]-3-[(3R)-3-(methylamino)pyrrolidin-1-yl]prop-2-enimidamide?
(E)-3-amino-N'-[(2S)-butan-2-yl]-3-[(3R)-3-(methylamino)pyrrolidin-1-yl]prop-2-enimidamide has a molecular weight of 239.37 g/mol, XLogP of 0.24, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-amino-N'-[(2S)-butan-2-yl]-3-[(3R)-3-(methylamino)pyrrolidin-1-yl]prop-2-enimidamide is sourced from PubChem (CID 89350974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).