C32H28F6N4O3 — CID 89351030
2-[9-(difluoromethyl)-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-N-[(1S)-2-(3,5-difluorophenyl)-1-[3-[4-(2-methoxyethoxy)phenyl]-2-pyridinyl]ethyl]acetamide (PubChem CID 89351030) has the molecular formula C32H28F6N4O3 and a molecular weight of 630.59 g/mol. Its IUPAC name is 2-[9-(difluoromethyl)-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-N-[(1S)-2-(3,5-difluorophenyl)-1-[3-[4-(2-methoxyethoxy)phenyl]-2-pyridinyl]ethyl]acetamide.
| Compound Name | 2-[9-(difluoromethyl)-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-N-[(1S)-2-(3,5-difluorophenyl)-1-[3-[4-(2-methoxyethoxy)phenyl]-2-pyridinyl]ethyl]acetamide |
|---|---|
| PubChem CID | 89351030 |
| Molecular Formula | C32H28F6N4O3 |
| Molecular Weight | 630.59 g/mol |
| Exact Mass | 630.21 |
| IUPAC Name | 2-[9-(difluoromethyl)-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-N-[(1S)-2-(3,5-difluorophenyl)-1-[3-[4-(2-methoxyethoxy)phenyl]-2-pyridinyl]ethyl]acetamide |
| SMILES | COCCOc1ccc(-c2cccnc2[C@H](Cc2cc(F)cc(F)c2)NC(=O)Cn2nc(C(F)F)c3c2C(F)(F)C2CC32)cc1 |
| InChI | InChI=1S/C32H28F6N4O3/c1-44-9-10-45-21-6-4-18(5-7-21)22-3-2-8-39-28(22)25(13-17-11-19(33)14-20(34)12-17)40-26(43)16-42-30-27(29(41-42)31(35)36)23-15-24(23)32(30,37)38/h2-8,11-12,14,23-25,31H,9-10,13,15-16H2,1H3,(H,40,43)/t23?,24?,25-/m0/s1 |
| InChIKey | DPWRFYJWNMLFSI-STEQJIOHSA-N |
| XLogP | 6.50 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.59 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|