C14H6BrF5O — CID 89351150
3-bromo-7-(2,3,4,5,6-pentafluorophenyl)bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol (PubChem CID 89351150) has the molecular formula C14H6BrF5O and a molecular weight of 365.10 g/mol. Its IUPAC name is 3-bromo-7-(2,3,4,5,6-pentafluorophenyl)bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol.
| Compound Name | 3-bromo-7-(2,3,4,5,6-pentafluorophenyl)bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol |
|---|---|
| PubChem CID | 89351150 |
| Molecular Formula | C14H6BrF5O |
| Molecular Weight | 365.10 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | 3-bromo-7-(2,3,4,5,6-pentafluorophenyl)bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol |
| SMILES | OC1(c2c(F)c(F)c(F)c(F)c2F)Cc2cc(Br)ccc21 |
| InChI | InChI=1S/C14H6BrF5O/c15-6-1-2-7-5(3-6)4-14(7,21)8-9(16)11(18)13(20)12(19)10(8)17/h1-3,21H,4H2 |
| InChIKey | QSYAMNMASGCOQF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.10 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|